Difference between revisions of "Ferrihemoglobins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-DIHYDROXY-PHENYLALANINE == * common-name: ** l-dopa * smiles: ** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-] * inchi-key: ** wtdrdqbearuvnc-...")
(Created page with "Category:metabolite == Metabolite Ferrihemoglobins == * common-name: ** a ferrihemoglobin == Reaction(s) known to consume the compound == * RXN-11195 == Reaction(s) kn...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-DIHYDROXY-PHENYLALANINE ==
+
== Metabolite Ferrihemoglobins ==
 
* common-name:
 
* common-name:
** l-dopa
+
** a ferrihemoglobin
* smiles:
 
** c(c(cc1(c=cc(o)=c(o)c=1))[n+])(=o)[o-]
 
* inchi-key:
 
** wtdrdqbearuvnc-lurjtmiesa-n
 
* molecular-weight:
 
** 197.19
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13061]]
+
* [[RXN-11195]]
* [[RXN-8460]]
 
* [[RXN66-221]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5861]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-dopa}}
+
{{#set: common-name=a ferrihemoglobin}}
{{#set: inchi-key=inchikey=wtdrdqbearuvnc-lurjtmiesa-n}}
 
{{#set: molecular-weight=197.19}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Ferrihemoglobins

  • common-name:
    • a ferrihemoglobin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality