Difference between revisions of "Charged-fMET-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-548 == * common-name: ** s-formylglutathione * smiles: ** c(nc(=o)c(csc=o)nc(=o)ccc([n+])c(=o)[o-])c(=o)[o-] * inchi-key: ** fhxagoic...") |
(Created page with "Category:metabolite == Metabolite Charged-fMET-tRNAs == * common-name: ** an n-formyl-l-methionylaminoacyl-trna == Reaction(s) known to consume the compound == * 3.5.1.2...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Charged-fMET-tRNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** an n-formyl-l-methionylaminoacyl-trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3.5.1.27-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an n-formyl-l-methionylaminoacyl-trna}} |
− | |||
− |
Latest revision as of 11:18, 18 March 2021
Contents
Metabolite Charged-fMET-tRNAs
- common-name:
- an n-formyl-l-methionylaminoacyl-trna