Difference between revisions of "PWY-6193"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] == * common-name: ** (5z)-tetradecenoyl-coa * smiles: ** ccccccccc=ccccc(s...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] == * common-name: ** (22α)-hydroxy-campesterol * smiles: ** cc(c)c(c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15436 CPD-15436] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3943 CPD-3943] ==
 
* common-name:
 
* common-name:
** (5z)-tetradecenoyl-coa
+
** (22α)-hydroxy-campesterol
 
* smiles:
 
* smiles:
** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** mrvdzohjmltlhj-stfckwfxsa-j
+
** lszjaiforslkoy-pacuacimsa-n
 
* molecular-weight:
 
* molecular-weight:
** 971.845
+
** 416.686
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14576]]
 
* [[RXN-17783]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17782]]
+
* [[RXN-4225]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-tetradecenoyl-coa}}
+
{{#set: common-name=(22α)-hydroxy-campesterol}}
{{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}}
+
{{#set: inchi-key=inchikey=lszjaiforslkoy-pacuacimsa-n}}
{{#set: molecular-weight=971.845}}
+
{{#set: molecular-weight=416.686}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-3943

  • common-name:
    • (22α)-hydroxy-campesterol
  • smiles:
    • cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • lszjaiforslkoy-pacuacimsa-n
  • molecular-weight:
    • 416.686

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality