Difference between revisions of "SJ12299"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8815 CPD-8815] == * common-name: ** 2,4-dihydroxybenzoate * smiles: ** cc1(=cc(=c(c=c1)c([o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-biotin-L-lysine BCCP-biotin-L-lysine] == * common-name: ** a [biotin carboxyl-carrier prot...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8815 CPD-8815] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-biotin-L-lysine BCCP-biotin-L-lysine] ==
 
* common-name:
 
* common-name:
** 2,4-dihydroxybenzoate
+
** a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine
* smiles:
 
** cc1(=cc(=c(c=c1)c([o-])=o)o)
 
* inchi-key:
 
** njesaxzanhetjv-uhfffaoysa-m
 
* molecular-weight:
 
** 151.141
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10078]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[BIOTINLIG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,4-dihydroxybenzoate}}
+
{{#set: common-name=a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine}}
{{#set: inchi-key=inchikey=njesaxzanhetjv-uhfffaoysa-m}}
 
{{#set: molecular-weight=151.141}}
 

Revision as of 14:19, 26 August 2019

Metabolite BCCP-biotin-L-lysine

  • common-name:
    • a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [biotin carboxyl-carrier protein]-biotin-n6-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.