Difference between revisions of "SJ21036"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] == * common-name: ** decanoyl-coa * smiles: ** cccccccccc(=o)sccnc(=o)ccnc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-Rubredoxins Oxidized-Rubredoxins] == * common-name: ** an oxidized rubredoxin == React...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10267 CPD-10267] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxidized-Rubredoxins Oxidized-Rubredoxins] ==
 
* common-name:
 
* common-name:
** decanoyl-coa
+
** an oxidized rubredoxin
* smiles:
 
** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** cnkjphsefdpydb-hsjnekgzsa-j
 
* molecular-weight:
 
** 917.754
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13615]]
 
* [[RXN-14274]]
 
* [[RXN-9628]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13614]]
+
* [[ALKANE-1-MONOOXYGENASE-RXN]]
* [[RXN-14274]]
 
* [[TRANS-2-ENOYL-COA-REDUCTASE-NAD+-RXN-CPD-10267/NAD//T2-DECENOYL-COA/NADH/PROTON.43.]]
 
* [[TRANSENOYLCOARED-RXN-CPD-10267/NADP//T2-DECENOYL-COA/NADPH/PROTON.45.]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=decanoyl-coa}}
+
{{#set: common-name=an oxidized rubredoxin}}
{{#set: inchi-key=inchikey=cnkjphsefdpydb-hsjnekgzsa-j}}
 
{{#set: molecular-weight=917.754}}
 

Revision as of 14:19, 26 August 2019

Metabolite Oxidized-Rubredoxins

  • common-name:
    • an oxidized rubredoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality