Difference between revisions of "SJ18177"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCCP-biotin-L-lysine BCCP-biotin-L-lysine] == * common-name: ** a [biotin carboxyl-carrier prot...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == * common-name: ** 3-methylcrotonyl-coa * smiles...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-methylcrotonyl-coa |
+ | * smiles: | ||
+ | ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c | ||
+ | * inchi-key: | ||
+ | ** bxipalatiynhjn-zmhdxicwsa-j | ||
+ | * molecular-weight: | ||
+ | ** 845.604 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ECH_LPAREN_3hivcoa_RPAREN_]] | ||
+ | * [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]] | ||
+ | * [[RXN-14264]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ECH_LPAREN_3hivcoa_RPAREN_]] |
+ | * [[IVCDH]] | ||
+ | * [[RXN-11921]] | ||
+ | * [[RXN-14264]] | ||
+ | * [[RXN0-2301]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-methylcrotonyl-coa}} |
+ | {{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}} | ||
+ | {{#set: molecular-weight=845.604}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite 3-METHYL-CROTONYL-COA
- common-name:
- 3-methylcrotonyl-coa
- smiles:
- cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
- inchi-key:
- bxipalatiynhjn-zmhdxicwsa-j
- molecular-weight:
- 845.604