Difference between revisions of "SJ09895"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] == * common-name: ** (+)-pinobanksin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Branched-chain-2-keto-acid-deHase Branched-chain-2-keto-acid-deHase] == * common-name: ** a bra...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6992 CPD-6992] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Branched-chain-2-keto-acid-deHase Branched-chain-2-keto-acid-deHase] ==
 
* common-name:
 
* common-name:
** (+)-pinobanksin
+
** a branched-chain 2-keto acid dehydrogenase
* smiles:
 
** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2o)=o)o)[o-])))=cc=3)
 
* inchi-key:
 
** suyjzkrqhbqnca-lsdhhaiusa-m
 
* molecular-weight:
 
** 271.249
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.11.4-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7648]]
+
* [[2.7.11.4-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-pinobanksin}}
+
{{#set: common-name=a branched-chain 2-keto acid dehydrogenase}}
{{#set: inchi-key=inchikey=suyjzkrqhbqnca-lsdhhaiusa-m}}
 
{{#set: molecular-weight=271.249}}
 

Revision as of 14:19, 26 August 2019

Metabolite Branched-chain-2-keto-acid-deHase

  • common-name:
    • a branched-chain 2-keto acid dehydrogenase

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality