Difference between revisions of "SJ11756"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5166 CPD-5166] == * common-name: ** α-d-man-(1→2)-α-d-man-(1→2)-&alph...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == * common-name: ** mycophenolic acid o-acyl-glucuronide * smiles: ** cc(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] == |
* common-name: | * common-name: | ||
− | ** | + | ** mycophenolic acid o-acyl-glucuronide |
+ | * smiles: | ||
+ | ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc) | ||
+ | * inchi-key: | ||
+ | ** qbmstezxamabff-uearnrkisa-m | ||
+ | * molecular-weight: | ||
+ | ** 495.459 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-13605]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13607]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=mycophenolic acid o-acyl-glucuronide}} |
+ | {{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}} | ||
+ | {{#set: molecular-weight=495.459}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-14602
- common-name:
- mycophenolic acid o-acyl-glucuronide
- smiles:
- cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
- inchi-key:
- qbmstezxamabff-uearnrkisa-m
- molecular-weight:
- 495.459