Difference between revisions of "SJ10331"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] == * common-name: ** indole-3-glycol * smiles: ** c2(=c(c1(c=c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * common-name: ** monodehydroascorbate radical * smiles: ** c(o)c(o)[ch]1(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE-3-GLYCOL INDOLE-3-GLYCOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
 
* common-name:
 
* common-name:
** indole-3-glycol
+
** monodehydroascorbate radical
 
* smiles:
 
* smiles:
** c2(=c(c1(c=cc=cc=1n2))c(o)co)
+
** c(o)c(o)[ch]1(c(o)=c(o)c(=o)o1)
 
* inchi-key:
 
* inchi-key:
** xnjdzrgywqbbmz-uhfffaoysa-n
+
** lhfjobmtajjotb-jlaznsocsa-n
 
* molecular-weight:
 
* molecular-weight:
** 177.202
+
** 175.118
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[1.6.5.4-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5424]]
+
* [[RXN-15598]]
 +
* [[RXN-3521]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=indole-3-glycol}}
+
{{#set: common-name=monodehydroascorbate radical}}
{{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=lhfjobmtajjotb-jlaznsocsa-n}}
{{#set: molecular-weight=177.202}}
+
{{#set: molecular-weight=175.118}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-318

  • common-name:
    • monodehydroascorbate radical
  • smiles:
    • c(o)c(o)[ch]1(c(o)=c(o)c(=o)o1)
  • inchi-key:
    • lhfjobmtajjotb-jlaznsocsa-n
  • molecular-weight:
    • 175.118

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality