Difference between revisions of "SJ01709"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=50S-Ribosomal-subunit-protein-L16-Arg 50S-Ribosomal-subunit-protein-L16-Arg] == * common-name:...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3710 CPD-3710] == * common-name: ** cytidine 2'-monophosphate * smiles: ** c(c2(c(c(c(n1(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=50S-Ribosomal-subunit-protein-L16-Arg 50S-Ribosomal-subunit-protein-L16-Arg] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3710 CPD-3710] ==
 
* common-name:
 
* common-name:
** a [50s ribosomal subunit protein l16]-l-arginine81
+
** cytidine 2'-monophosphate
 +
* smiles:
 +
** c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o
 +
* inchi-key:
 +
** yquakormlhpslz-xvfcmesisa-l
 +
* molecular-weight:
 +
** 321.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-7090]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12059]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [50s ribosomal subunit protein l16]-l-arginine81}}
+
{{#set: common-name=cytidine 2'-monophosphate}}
 +
{{#set: inchi-key=inchikey=yquakormlhpslz-xvfcmesisa-l}}
 +
{{#set: molecular-weight=321.183}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-3710

  • common-name:
    • cytidine 2'-monophosphate
  • smiles:
    • c(c2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)op([o-])([o-])=o)o))o
  • inchi-key:
    • yquakormlhpslz-xvfcmesisa-l
  • molecular-weight:
    • 321.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality