Difference between revisions of "SJ00047"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=pppGp-his-tRNAs pppGp-his-tRNAs] == * common-name: ** 5'-triphospho-guanosine-ribonucleotide-[t...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOHEXAOSE MALTOHEXAOSE] == * common-name: ** maltohexaose * smiles: ** c(c6(oc(oc5(c(oc(oc4(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOHEXAOSE MALTOHEXAOSE] == |
* common-name: | * common-name: | ||
− | ** | + | ** maltohexaose |
+ | * smiles: | ||
+ | ** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o | ||
+ | * inchi-key: | ||
+ | ** ocibbxpluvykch-liggpisvsa-n | ||
+ | * molecular-weight: | ||
+ | ** 990.867 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14282]] | ||
+ | * [[RXN-14285]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14283]] |
− | * [[RXN- | + | * [[RXN-14286]] |
+ | * [[RXN0-5181]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=maltohexaose}} |
+ | {{#set: inchi-key=inchikey=ocibbxpluvykch-liggpisvsa-n}} | ||
+ | {{#set: molecular-weight=990.867}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite MALTOHEXAOSE
- common-name:
- maltohexaose
- smiles:
- c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o
- inchi-key:
- ocibbxpluvykch-liggpisvsa-n
- molecular-weight:
- 990.867