Difference between revisions of "SJ01766"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-108 CPD-108] == * common-name: ** 4-methylphenol * smiles: ** cc1(c=cc(=cc=1)o) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * common-name: ** 3-phospho-d-glyceroyl-phosphate * smiles: ** c(c(o)c(op(=o)([o-])...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-phospho-d-glyceroyl-phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ljqlqcaxbuheaz-uwtatzphsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 262.006 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[BISPHOSPHOGLYCERATE-MUTASE-RXN]] |
+ | * [[GAPDHSYNEC-RXN]] | ||
+ | * [[GAPDH_]] | ||
+ | * [[GAPOXNPHOSPHN-RXN]] | ||
+ | * [[PHOSGLYPHOS-RXN]] | ||
+ | * [[RXN-17274]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[GAPDHSYNEC-RXN]] |
− | * [[RXN | + | * [[GAPDH_]] |
+ | * [[GAPOXNPHOSPHN-RXN]] | ||
+ | * [[PHOSGLYPHOS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-phospho-d-glyceroyl-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ljqlqcaxbuheaz-uwtatzphsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=262.006}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite DPG
- common-name:
- 3-phospho-d-glyceroyl-phosphate
- smiles:
- c(c(o)c(op(=o)([o-])[o-])=o)op(=o)([o-])[o-]
- inchi-key:
- ljqlqcaxbuheaz-uwtatzphsa-j
- molecular-weight:
- 262.006