Difference between revisions of "SJ10585"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Prime-Phosphate-Terminated-RNAs 3-Prime-Phosphate-Terminated-RNAs] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] ==
 * common-name:
-** an [rna]-3'-ribonucleoside-3'-phosphate
+** sn-glycerol 3-phosphate
+* smiles:
+** c(op([o-])(=o)[o-])c(o)co
+* inchi-key:
+** awucvroldviajx-gsvougtgsa-l
+* molecular-weight:
+** 170.058
 == Reaction(s) known to consume the compound ==
-* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
+* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+* [[G3PD2]]
+* [[GLYCEROL-3-PHOSPHATE-OXIDASE-RXN]]
+* [[GLYCEROL-KIN-RXN]]
+* [[PHOSPHAGLYPSYN-RXN]]
+* [[RXN-10462]]
+* [[RXN-13112]]
+* [[RXN-13805]]
+* [[RXN-1381]]
+* [[RXN-14965]]
+* [[RXN-15045]]
+* [[RXN-15740]]
+* [[RXN-15745]]
+* [[RXN-16024]]
+* [[RXN-16117]]
+* [[RXN-17016]]
+* [[RXN-17017]]
+* [[RXN-17018]]
+* [[RXN0-5260]]
 == Reaction(s) known to produce the compound ==
+* [[1.1.1.8-RXN]]
+* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+* [[G3PD2]]
+* [[GLYC3PDEHYDROGBIOSYN-RXN]]
+* [[GLYCEROL-KIN-RXN]]
+* [[GLYCPDIESTER-RXN]]
+* [[RXN-13112]]
+* [[RXN-13805]]
+* [[RXN-14073]]
+* [[RXN-14136]]
+* [[RXN-14160]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=an [rna]-3'-ribonucleoside-3'-phosphate}}
+{{#set: common-name=sn-glycerol 3-phosphate}}
+{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}
+{{#set: molecular-weight=170.058}}