Difference between revisions of "SJ14441"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRIN_III COPROPORPHYRIN_III] == * common-name: ** coproporphyrin iii * smiles: ** cc1...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * common-name: ** phytyl monophosphate * smiles: ** cc(cccc(cccc(c)cccc(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRIN_III COPROPORPHYRIN_III] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] ==
 
* common-name:
 
* common-name:
** coproporphyrin iii
+
** phytyl monophosphate
 
* smiles:
 
* smiles:
** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
+
** cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
 
* inchi-key:
 
* inchi-key:
** jwfcywsmnrlxlx-ujjxfscmsa-j
+
** yrxrhzokdfcxib-pyddkjgssa-l
 
* molecular-weight:
 
* molecular-weight:
** 650.687
+
** 374.499
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17518]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17517]]
+
* [[RXN-7683]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrin iii}}
+
{{#set: common-name=phytyl monophosphate}}
{{#set: inchi-key=inchikey=jwfcywsmnrlxlx-ujjxfscmsa-j}}
+
{{#set: inchi-key=inchikey=yrxrhzokdfcxib-pyddkjgssa-l}}
{{#set: molecular-weight=650.687}}
+
{{#set: molecular-weight=374.499}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-7025

  • common-name:
    • phytyl monophosphate
  • smiles:
    • cc(cccc(cccc(c)cccc(c)=ccop([o-])(=o)[o-])c)c
  • inchi-key:
    • yrxrhzokdfcxib-pyddkjgssa-l
  • molecular-weight:
    • 374.499

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality