Difference between revisions of "SJ13652"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12018 CPD-12018] == * common-name: ** 5-methoxytryptamine * smiles: ** coc2(c=cc1(=c(c(ccn)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-1P GLUCOSAMINE-1P] == * common-name: ** d-glucosamine 1-phosphate * smiles: ** c(o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-1P GLUCOSAMINE-1P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-glucosamine 1-phosphate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ymjbyrvfgyxulk-qzabapfnsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 258.144 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.3.1.157-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-glucosamine 1-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ymjbyrvfgyxulk-qzabapfnsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=258.144}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite GLUCOSAMINE-1P
- common-name:
- d-glucosamine 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c([n+])c(o)c(o)1)
- inchi-key:
- ymjbyrvfgyxulk-qzabapfnsa-m
- molecular-weight:
- 258.144
