Difference between revisions of "SJ19146"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17293 CPD-17293] == * common-name: ** a [glycerolipid]-(7z,10z)-hexadecadienoate == Reactio...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] == * common-name: ** 4-nitrophenyl phosphate * smiles: ** c1(=cc(op([o-])(=o)[...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-nitrophenyl phosphate |
+ | * smiles: | ||
+ | ** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1) | ||
+ | * inchi-key: | ||
+ | ** xzkihkmtemtjqx-uhfffaoysa-l | ||
+ | * molecular-weight: | ||
+ | ** 217.074 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[4-NITROPHENYLPHOSPHATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-nitrophenyl phosphate}} |
+ | {{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=217.074}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-194
- common-name:
- 4-nitrophenyl phosphate
- smiles:
- c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
- inchi-key:
- xzkihkmtemtjqx-uhfffaoysa-l
- molecular-weight:
- 217.074