Difference between revisions of "SJ13528"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] == * common-name: ** (+)-7-epi-jasmonate * smiles: ** ccc=ccc1(c(=o)ccc1cc([o-...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-RNA Unwound-RNA] == * common-name: ** an unwound rna == Reaction(s) known to consume th...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-731 CPD-731] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-RNA Unwound-RNA] ==
 
* common-name:
 
* common-name:
** (+)-7-epi-jasmonate
+
** an unwound rna
* smiles:
 
** ccc=ccc1(c(=o)ccc1cc([o-])=o)
 
* inchi-key:
 
** znjfbwydhiglcu-qkmqqoolsa-m
 
* molecular-weight:
 
** 209.264
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10708]]
+
* [[RXN-11109]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-7-epi-jasmonate}}
+
{{#set: common-name=an unwound rna}}
{{#set: inchi-key=inchikey=znjfbwydhiglcu-qkmqqoolsa-m}}
 
{{#set: molecular-weight=209.264}}
 

Revision as of 14:20, 26 August 2019

Metabolite Unwound-RNA

  • common-name:
    • an unwound rna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality