Difference between revisions of "SJ02834"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12852 CPD-12852] == * common-name: ** 4α,14α-dimethyl-5α-cholesta-8,24-di...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETALDEHYDE 5-HYDROXYINDOLE_ACETALDEHYDE] == * common-name: ** 5-hydroxyindole...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYINDOLE_ACETALDEHYDE 5-HYDROXYINDOLE_ACETALDEHYDE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxyindole acetaldehyde |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** obfapciusyhfie-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 175.187 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-10780]] |
| + | * [[RXN-10781]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10778]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxyindole acetaldehyde}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=obfapciusyhfie-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=175.187}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite 5-HYDROXYINDOLE_ACETALDEHYDE
- common-name:
- 5-hydroxyindole acetaldehyde
- smiles:
- c1(nc2(c(c(cc=o)=1)=cc(=cc=2)o))
- inchi-key:
- obfapciusyhfie-uhfffaoysa-n
- molecular-weight:
- 175.187
