Difference between revisions of "SJ02315"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Unwound-RNA Unwound-RNA] == * common-name: ** an unwound rna == Reaction(s) known to consume th...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] == * common-name: ** d-myo-inositol (3,4,5,6)-tetrakisphosphate * smiles: ** c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-178 CPD-178] == |
* common-name: | * common-name: | ||
− | ** | + | ** d-myo-inositol (3,4,5,6)-tetrakisphosphate |
+ | * smiles: | ||
+ | ** c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) | ||
+ | * inchi-key: | ||
+ | ** mrvyfoanpdtyby-uzaagftcsa-f | ||
+ | * molecular-weight: | ||
+ | ** 492.013 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.7.1.134-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (3,4,5,6)-tetrakisphosphate}} |
+ | {{#set: inchi-key=inchikey=mrvyfoanpdtyby-uzaagftcsa-f}} | ||
+ | {{#set: molecular-weight=492.013}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-178
- common-name:
- d-myo-inositol (3,4,5,6)-tetrakisphosphate
- smiles:
- c1(o)(c(o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- mrvyfoanpdtyby-uzaagftcsa-f
- molecular-weight:
- 492.013