Difference between revisions of "SJ11389"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALCOHOL CONIFERYL-ALCOHOL] == * common-name: ** coniferyl alcohol * smiles: ** coc1(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12825 CPD-12825] == * common-name: ** d-threitol * smiles: ** c(c(c(co)o)o)o * inchi-key: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALCOHOL CONIFERYL-ALCOHOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12825 CPD-12825] ==
 
* common-name:
 
* common-name:
** coniferyl alcohol
+
** d-threitol
 
* smiles:
 
* smiles:
** coc1(=cc(c=cco)=cc=c(o)1)
+
** c(c(c(co)o)o)o
 
* inchi-key:
 
* inchi-key:
** jmfrwrfflbvwsi-nscuhmnnsa-n
+
** unxhwfmmpawvpi-qwwzwvqmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 180.203
+
** 122.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17351]]
+
* [[ERYTHRULOSE-REDUCTASE-RXN]]
* [[RXN-17352]]
+
* [[RXN-17773]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ERYTHRULOSE-REDUCTASE-RXN]]
 +
* [[RXN-17773]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coniferyl alcohol}}
+
{{#set: common-name=d-threitol}}
{{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}}
+
{{#set: inchi-key=inchikey=unxhwfmmpawvpi-qwwzwvqmsa-n}}
{{#set: molecular-weight=180.203}}
+
{{#set: molecular-weight=122.121}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-12825

  • common-name:
    • d-threitol
  • smiles:
    • c(c(c(co)o)o)o
  • inchi-key:
    • unxhwfmmpawvpi-qwwzwvqmsa-n
  • molecular-weight:
    • 122.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality