Difference between revisions of "SJ01066"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] == * common-name: ** 3-o-methylkaempferol * smiles: ** coc3(c(=o)c1(c(=cc(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Core1 Core1] == * common-name: ** core 1 == Reaction(s) known to consume the compound == == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14950 CPD-14950] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Core1 Core1] ==
 
* common-name:
 
* common-name:
** 3-o-methylkaempferol
+
** core 1
* smiles:
 
** coc3(c(=o)c1(c(=cc(o)=cc(o)=1)oc(c2(c=cc(o)=cc=2))=3))
 
* inchi-key:
 
** vjjzjbucdwkplc-uhfffaoysa-n
 
* molecular-weight:
 
** 300.267
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13935]]
+
* [[2.4.1.122-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-o-methylkaempferol}}
+
{{#set: common-name=core 1}}
{{#set: inchi-key=inchikey=vjjzjbucdwkplc-uhfffaoysa-n}}
 
{{#set: molecular-weight=300.267}}
 

Revision as of 14:20, 26 August 2019

Metabolite Core1

  • common-name:
    • core 1

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality