Difference between revisions of "SJ11122"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18733 CPD-18733] == * common-name: ** 4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinol...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10198 CPD-10198] == * common-name: ** furaneol == Reaction(s) known to consume the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18733 CPD-18733] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10198 CPD-10198] ==
 
* common-name:
 
* common-name:
** 4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide
+
** furaneol
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=ccc2(o)(c1(c=cc=cc=1[n+](=c(c)c(=o)2)[o-]))
 
* inchi-key:
 
** rnxnmmdmlfjckp-yefhwucqsa-n
 
* molecular-weight:
 
** 395.541
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17334]]
+
* [[RXN-9563]]
* [[RXN-17335]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxy-2-methyl-3-oxo-4-farnesyl-3,4-dihydroquinoline-1-oxide}}
+
{{#set: common-name=furaneol}}
{{#set: inchi-key=inchikey=rnxnmmdmlfjckp-yefhwucqsa-n}}
 
{{#set: molecular-weight=395.541}}
 

Revision as of 14:20, 26 August 2019

Metabolite CPD-10198

  • common-name:
    • furaneol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality