Difference between revisions of "PWY-5074"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-L-RHAMNOSE UDP-L-RHAMNOSE] == * common-name: ** udp-β-l-rhamnose * smiles: ** cc3(oc(o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-methyl-terminal-XPK N-methyl-terminal-XPK] == * common-name: ** an n terminal n-methyl-(a/s)p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-L-RHAMNOSE UDP-L-RHAMNOSE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-methyl-terminal-XPK N-methyl-terminal-XPK] ==
 
* common-name:
 
* common-name:
** udp-β-l-rhamnose
+
** an n terminal n-methyl-(a/s)pk-[protein]
* smiles:
 
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
 
* inchi-key:
 
** drdcjeizvlvwnc-slbwpepysa-l
 
* molecular-weight:
 
** 548.29
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12890]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10740]]
+
* [[RXN-12889]]
* [[RXN-5482]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-β-l-rhamnose}}
+
{{#set: common-name=an n terminal n-methyl-(a/s)pk-[protein]}}
{{#set: inchi-key=inchikey=drdcjeizvlvwnc-slbwpepysa-l}}
 
{{#set: molecular-weight=548.29}}
 

Revision as of 09:22, 27 August 2019

Metabolite N-methyl-terminal-XPK

  • common-name:
    • an n terminal n-methyl-(a/s)pk-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n terminal n-methyl-(a/s)pk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.