Difference between revisions of "PWY-7571"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] == * common-name: ** 7-hydroxylauroyl-coa * smiles: ** cccccc(o)cccccc(=o)...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ssRNAs ssRNAs] == * common-name: ** a single-stranded rna == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ssRNAs ssRNAs] ==
 
* common-name:
 
* common-name:
** 7-hydroxylauroyl-coa
+
** a single-stranded rna
* smiles:
 
** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** rxedusgpuqqzew-xirpngcasa-j
 
* molecular-weight:
 
** 961.807
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.7.8-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12184]]
+
* [[2.7.7.8-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7-hydroxylauroyl-coa}}
+
{{#set: common-name=a single-stranded rna}}
{{#set: inchi-key=inchikey=rxedusgpuqqzew-xirpngcasa-j}}
 
{{#set: molecular-weight=961.807}}
 

Revision as of 09:22, 27 August 2019

Metabolite ssRNAs

  • common-name:
    • a single-stranded rna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality