Difference between revisions of "PWY-6370"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] == * common-name: ** 4'-apo-β-carotenal * smiles: ** cc(c=cc=c(c)c=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] == * common-name: ** (3r,5s)-3-hyd...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12935 CPD-12935] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] ==
 
* common-name:
 
* common-name:
** 4'-apo-β-carotenal
+
** (3r,5s)-3-hydroxy-1-pyrroline-5-carboxylate
 
* smiles:
 
* smiles:
** cc(c=cc=c(c)c=cc=c(c)c=o)=cc=cc=c(c)c=cc=c(c)c=cc1(c(c)(c)cccc(c)=1)
+
** c1(=nc(c([o-])=o)cc(o)1)
 
* inchi-key:
 
* inchi-key:
** ftqsfezuhzhoat-brzoagjpsa-n
+
** wfofkrkddkgrik-dmtcnviqsa-m
 
* molecular-weight:
 
* molecular-weight:
** 482.748
+
** 128.107
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-546]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11989]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4'-apo-β-carotenal}}
+
{{#set: common-name=(3r,5s)-3-hydroxy-1-pyrroline-5-carboxylate}}
{{#set: inchi-key=inchikey=ftqsfezuhzhoat-brzoagjpsa-n}}
+
{{#set: inchi-key=inchikey=wfofkrkddkgrik-dmtcnviqsa-m}}
{{#set: molecular-weight=482.748}}
+
{{#set: molecular-weight=128.107}}

Revision as of 09:22, 27 August 2019

Metabolite PYRROLINE-HYDROXY-CARBOXYLATE

  • common-name:
    • (3r,5s)-3-hydroxy-1-pyrroline-5-carboxylate
  • smiles:
    • c1(=nc(c([o-])=o)cc(o)1)
  • inchi-key:
    • wfofkrkddkgrik-dmtcnviqsa-m
  • molecular-weight:
    • 128.107

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality