Difference between revisions of "PWY-4984"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNAs tRNAs] == * common-name: ** an uncharged trna == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == * common-name: ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiper...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17050 CPD-17050] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine |
| + | * smiles: | ||
| + | ** c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3) | ||
| + | * inchi-key: | ||
| + | ** poiijaagmgnxlo-vxgbxaggsa-n | ||
| + | * molecular-weight: | ||
| + | ** 296.358 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-15684]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine}} |
| + | {{#set: inchi-key=inchikey=poiijaagmgnxlo-vxgbxaggsa-n}} | ||
| + | {{#set: molecular-weight=296.358}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-17050
- common-name:
- 3-benzyl-3,6 -disulfide-6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(o)c23(ssc(cc1(=cc=cc=c1))(nc(=o)2)c(=o)n3)
- inchi-key:
- poiijaagmgnxlo-vxgbxaggsa-n
- molecular-weight:
- 296.358
