Difference between revisions of "PWY-7356"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRIPEPTIDES TRIPEPTIDES] == * common-name: ** a tripeptide == Reaction(s) known to consume the...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == * common-name: ** β-d-cellobiose * smiles: ** c(c2(c(c(c(c(oc1(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CELLOBIOSE CELLOBIOSE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-cellobiose |
| + | * smiles: | ||
| + | ** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o | ||
| + | * inchi-key: | ||
| + | ** gubgytabksrvrq-qrzgkkjrsa-n | ||
| + | * molecular-weight: | ||
| + | ** 342.299 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10773]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[3. | + | * [[3.2.1.91-RXN]] |
| − | * [[ | + | * [[RXN-12305]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-cellobiose}} |
| + | {{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}} | ||
| + | {{#set: molecular-weight=342.299}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CELLOBIOSE
- common-name:
- β-d-cellobiose
- smiles:
- c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o
- inchi-key:
- gubgytabksrvrq-qrzgkkjrsa-n
- molecular-weight:
- 342.299
