Difference between revisions of "PWY-6894"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-824 CPD-824] == * common-name: ** 5-guanidino-2-oxopentanoate * smiles: ** c(c(cccnc(=[n+])...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sphingoids Sphingoids] == * common-name: ** a sphingoid base == Reaction(s) known to consume th...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-824 CPD-824] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Sphingoids Sphingoids] ==
 
* common-name:
 
* common-name:
** 5-guanidino-2-oxopentanoate
+
** a sphingoid base
* smiles:
 
** c(c(cccnc(=[n+])n)=o)(=o)[o-]
 
* inchi-key:
 
** arbhxjxxvvhmet-uhfffaoysa-n
 
* molecular-weight:
 
** 173.171
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11376]]
 +
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ARG-OXIDATION-RXN]]
+
* [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-guanidino-2-oxopentanoate}}
+
{{#set: common-name=a sphingoid base}}
{{#set: inchi-key=inchikey=arbhxjxxvvhmet-uhfffaoysa-n}}
 
{{#set: molecular-weight=173.171}}
 

Revision as of 09:22, 27 August 2019

Metabolite Sphingoids

  • common-name:
    • a sphingoid base

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality