Difference between revisions of "PWY-695"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23S-rRNA-5-methyluracil1939 23S-rRNA-5-methyluracil1939] == * common-name: ** a 5-methyluracil1...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == * common-name: ** γ-l-glutamyl-glycylglycine * smiles: ** c(nc(cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19395 CPD-19395] == |
* common-name: | * common-name: | ||
| − | ** | + | ** γ-l-glutamyl-glycylglycine |
| + | * smiles: | ||
| + | ** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o | ||
| + | * inchi-key: | ||
| + | ** rwazieyjawtklb-yfkpbyrvsa-m | ||
| + | * molecular-weight: | ||
| + | ** 260.226 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-18092]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=γ-l-glutamyl-glycylglycine}} |
| + | {{#set: inchi-key=inchikey=rwazieyjawtklb-yfkpbyrvsa-m}} | ||
| + | {{#set: molecular-weight=260.226}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-19395
- common-name:
- γ-l-glutamyl-glycylglycine
- smiles:
- c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o
- inchi-key:
- rwazieyjawtklb-yfkpbyrvsa-m
- molecular-weight:
- 260.226
