Difference between revisions of "PWY-7050"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1789 CPD-1789] == * common-name: ** dehydro-d-arabinono-1,4-lactone * smiles: ** c(o)c1(c(o...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10576 CPD-10576] == * common-name: ** 4-chlorosalicylate * smiles: ** c(c1(c=cc(cl)=cc=1o))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10576 CPD-10576] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-chlorosalicylate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(c1(c=cc(cl)=cc=1o))([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lwxfczxrfbuoor-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 171.56 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9912]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-chlorosalicylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lwxfczxrfbuoor-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=171.56}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-10576
- common-name:
- 4-chlorosalicylate
- smiles:
- c(c1(c=cc(cl)=cc=1o))([o-])=o
- inchi-key:
- lwxfczxrfbuoor-uhfffaoysa-m
- molecular-weight:
- 171.56
