Difference between revisions of "PWY-5152"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ssDNA-RNA-primer-hybrid ssDNA-RNA-primer-hybrid] == * common-name: ** an ssdna/rna primer hybri...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == * common-name: ** 2-iminosuccinate * smiles: ** c(=o)([o-])cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=IMINOASPARTATE IMINOASPARTATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** 2-iminosuccinate |
+ | * smiles: | ||
+ | ** c(=o)([o-])cc(=n)c(=o)[o-] | ||
+ | * inchi-key: | ||
+ | ** nmuoatvllqeyhi-uhfffaoysa-l | ||
+ | * molecular-weight: | ||
+ | ** 129.072 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[QUINOLINATE-SYNTHA-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[L-ASPARTATE-OXID-RXN]] |
+ | * [[RXN-9772]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2-iminosuccinate}} |
+ | {{#set: inchi-key=inchikey=nmuoatvllqeyhi-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=129.072}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite IMINOASPARTATE
- common-name:
- 2-iminosuccinate
- smiles:
- c(=o)([o-])cc(=n)c(=o)[o-]
- inchi-key:
- nmuoatvllqeyhi-uhfffaoysa-l
- molecular-weight:
- 129.072