Difference between revisions of "PWY-6307"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methylated-Ribosomal-Protein-L11s Methylated-Ribosomal-Protein-L11s] ==
 * common-name:
-** 5-amino-1-(5-phospho-&beta;-d-ribosyl)imidazole
+** a methylated ribosomal protein l11
-* smiles:
-** c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)
-* inchi-key:
-** pdacukokvhbvhj-xvfcmesisa-m
-* molecular-weight:
-** 294.18
 == Reaction(s) known to consume the compound ==
-* [[AIRCARBOXY-RXN]]
-* [[PYRIMSYN1-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[AIRCARBOXY-RXN]]
+* [[RXN0-5419]]
-* [[AIRS-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=5-amino-1-(5-phospho-&beta;-d-ribosyl)imidazole}}
+{{#set: common-name=a methylated ribosomal protein l11}}
-{{#set: inchi-key=inchikey=pdacukokvhbvhj-xvfcmesisa-m}}
-{{#set: molecular-weight=294.18}}