Difference between revisions of "SJ04816"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL] == * common-name:...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ THZ] == * common-name: ** 5-(2-hydroxyethyl)-4-methylthiazole * smiles: ** cc1(n=csc(cco)=1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL 2-HEXAPRENYL-6-METHOXY-14-BENZOQUINOL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ THZ] ==
 
* common-name:
 
* common-name:
** 2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol
+
** 5-(2-hydroxyethyl)-4-methylthiazole
 
* smiles:
 
* smiles:
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(=c(oc)c=c(c=1)o)o))c)c)c)c)c
+
** cc1(n=csc(cco)=1)
 
* inchi-key:
 
* inchi-key:
** zagwhopypmukok-fricuitqsa-n
+
** bkawjirckvuved-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 548.848
+
** 143.203
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN3O-54]]
+
* [[THIAZOLSYN3-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[THIAMINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methoxy-6-all trans-hexaprenyl-1,4-benzoquinol}}
+
{{#set: common-name=5-(2-hydroxyethyl)-4-methylthiazole}}
{{#set: inchi-key=inchikey=zagwhopypmukok-fricuitqsa-n}}
+
{{#set: inchi-key=inchikey=bkawjirckvuved-uhfffaoysa-n}}
{{#set: molecular-weight=548.848}}
+
{{#set: molecular-weight=143.203}}

Revision as of 09:23, 27 August 2019

Metabolite THZ

  • common-name:
    • 5-(2-hydroxyethyl)-4-methylthiazole
  • smiles:
    • cc1(n=csc(cco)=1)
  • inchi-key:
    • bkawjirckvuved-uhfffaoysa-n
  • molecular-weight:
    • 143.203

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality