Difference between revisions of "SJ21697"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALANINE D-ALANINE] == * common-name: ** d-alanine * smiles: ** cc([n+])c([o-])=o * inchi-key:...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] == * common-name: ** menaquinol-11 * smiles: ** cc(=cccc(=cccc(=cccc(c)=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALANINE D-ALANINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12128 CPD-12128] ==
 
* common-name:
 
* common-name:
** d-alanine
+
** menaquinol-11
 
* smiles:
 
* smiles:
** cc([n+])c([o-])=o
+
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
 
* inchi-key:
 
* inchi-key:
** qnaybmklocpygj-uwtatzphsa-n
+
** zxhqkrgmwkzwgn-ryzszpjesa-n
 
* molecular-weight:
 
* molecular-weight:
** 89.094
+
** 923.499
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
 
* [[DALADALALIG-RXN]]
 
* [[RXN-8672]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[D-ALANINE-AMINOTRANSFERASE-RXN]]
+
* [[RXN-9362]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-alanine}}
+
{{#set: common-name=menaquinol-11}}
{{#set: inchi-key=inchikey=qnaybmklocpygj-uwtatzphsa-n}}
+
{{#set: inchi-key=inchikey=zxhqkrgmwkzwgn-ryzszpjesa-n}}
{{#set: molecular-weight=89.094}}
+
{{#set: molecular-weight=923.499}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-12128

  • common-name:
    • menaquinol-11
  • smiles:
    • cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(c)=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
  • inchi-key:
    • zxhqkrgmwkzwgn-ryzszpjesa-n
  • molecular-weight:
    • 923.499

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality