Difference between revisions of "SJ16962"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Myosin-heavy-chains Myosin-heavy-chains] == * common-name: ** a myosin heavy chain == Reaction(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * common-name: ** dihydrozeatin-o-glucoside * smiles: ** cc(ccnc1(c2(=c(n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == |
* common-name: | * common-name: | ||
| − | ** | + | ** dihydrozeatin-o-glucoside |
| + | * smiles: | ||
| + | ** cc(ccnc1(c2(=c(n=cn=1)nc=n2)))coc3(c(c(c(c(o3)co)o)o)o) | ||
| + | * inchi-key: | ||
| + | ** qrzhdhjuybonqq-jsymrtrdsa-n | ||
| + | * molecular-weight: | ||
| + | ** 383.403 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-4726]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dihydrozeatin-o-glucoside}} |
| + | {{#set: inchi-key=inchikey=qrzhdhjuybonqq-jsymrtrdsa-n}} | ||
| + | {{#set: molecular-weight=383.403}} | ||
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-4617
- common-name:
- dihydrozeatin-o-glucoside
- smiles:
- cc(ccnc1(c2(=c(n=cn=1)nc=n2)))coc3(c(c(c(c(o3)co)o)o)o)
- inchi-key:
- qrzhdhjuybonqq-jsymrtrdsa-n
- molecular-weight:
- 383.403
