Difference between revisions of "SJ21612"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] == * common-name: ** 3-oxo-(5z)-dodecenoyl-coa * smiles: ** ccccccc=ccc(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == * common-name: ** d-glucarate * smiles: ** c(=o)(c(o)c(o)c(o)c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19153 CPD-19153] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] ==
 
* common-name:
 
* common-name:
** 3-oxo-(5z)-dodecenoyl-coa
+
** d-glucarate
 
* smiles:
 
* smiles:
** ccccccc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** vklhslowdwgvgp-cggpsvllsa-j
+
** dslzvsrjtyrbfb-lleiaeiesa-l
 
* molecular-weight:
 
* molecular-weight:
** 957.775
+
** 208.124
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17799]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17798]]
+
* [[RXN-14225]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(5z)-dodecenoyl-coa}}
+
{{#set: common-name=d-glucarate}}
{{#set: inchi-key=inchikey=vklhslowdwgvgp-cggpsvllsa-j}}
+
{{#set: inchi-key=inchikey=dslzvsrjtyrbfb-lleiaeiesa-l}}
{{#set: molecular-weight=957.775}}
+
{{#set: molecular-weight=208.124}}

Revision as of 09:23, 27 August 2019

Metabolite D-GLUCARATE

  • common-name:
    • d-glucarate
  • smiles:
    • c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-]
  • inchi-key:
    • dslzvsrjtyrbfb-lleiaeiesa-l
  • molecular-weight:
    • 208.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality