Difference between revisions of "SJ11756"

Revision as of 09:23, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14602 CPD-14602] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7867 CPD-7867] ==
 * common-name:
-** mycophenolic acid o-acyl-glucuronide
+** 1-dodecanol
 * smiles:
-** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
+** cccccccccccco
 * inchi-key:
-** qbmstezxamabff-uearnrkisa-m
+** lqzzuxjywnfbmv-uhfffaoysa-n
 * molecular-weight:
-** 495.459
+** 186.337
 == Reaction(s) known to consume the compound ==
-* [[RXN-13605]]
+* [[RXN-9356]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13607]]
+* [[RXN-9356]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=mycophenolic acid o-acyl-glucuronide}}
+{{#set: common-name=1-dodecanol}}
-{{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}}
+{{#set: inchi-key=inchikey=lqzzuxjywnfbmv-uhfffaoysa-n}}
-{{#set: molecular-weight=495.459}}
+{{#set: molecular-weight=186.337}}