Difference between revisions of "SJ05117"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA-TOCOPHEROL DELTA-TOCOPHEROL] == * common-name: ** δ-tocopherol * smiles: ** cc(c)cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] == * common-name: ** (2r)-homocitrate * smiles: ** c(c([o-])=o)cc(o)(c([o-])...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA-TOCOPHEROL DELTA-TOCOPHEROL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] ==
 
* common-name:
 
* common-name:
** δ-tocopherol
+
** (2r)-homocitrate
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c))
+
** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** gzifeoyasatjeh-vhfrwlagsa-n
+
** xkjvevrqmlksmo-ssdottswsa-k
 
* molecular-weight:
 
* molecular-weight:
** 402.659
+
** 203.128
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2562]]
+
* [[RXN-13722]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13722]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=δ-tocopherol}}
+
{{#set: common-name=(2r)-homocitrate}}
{{#set: inchi-key=inchikey=gzifeoyasatjeh-vhfrwlagsa-n}}
+
{{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}}
{{#set: molecular-weight=402.659}}
+
{{#set: molecular-weight=203.128}}

Revision as of 09:24, 27 August 2019

Metabolite HOMO-CIT

  • common-name:
    • (2r)-homocitrate
  • smiles:
    • c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o
  • inchi-key:
    • xkjvevrqmlksmo-ssdottswsa-k
  • molecular-weight:
    • 203.128

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality