Difference between revisions of "SJ05246"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15237 CPD-15237] == * common-name: ** glucosyl-(heptosyl)3-glucosyluronate-kdo2-lipid a-pho...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-TOCOPHEROL BETA-TOCOPHEROL] == * common-name: ** β-tocopherol * smiles: ** cc(c)cccc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BETA-TOCOPHEROL BETA-TOCOPHEROL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-tocopherol |
| + | * smiles: | ||
| + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) | ||
| + | * inchi-key: | ||
| + | ** wgvkwnupngfdfj-dqczwyhmsa-n | ||
| + | * molecular-weight: | ||
| + | ** 416.686 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-2562]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-tocopherol}} |
| + | {{#set: inchi-key=inchikey=wgvkwnupngfdfj-dqczwyhmsa-n}} | ||
| + | {{#set: molecular-weight=416.686}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite BETA-TOCOPHEROL
- common-name:
- β-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c))
- inchi-key:
- wgvkwnupngfdfj-dqczwyhmsa-n
- molecular-weight:
- 416.686
