Difference between revisions of "SJ10331"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * common-name: ** monodehydroascorbate radical * smiles: ** c(o)c(o)[ch]1(c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-GLUTATHIONE OXIDIZED-GLUTATHIONE] == * common-name: ** glutathione disulfide * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-GLUTATHIONE OXIDIZED-GLUTATHIONE] ==
 
* common-name:
 
* common-name:
** monodehydroascorbate radical
+
** glutathione disulfide
 
* smiles:
 
* smiles:
** c(o)c(o)[ch]1(c(o)=c(o)c(=o)o1)
+
** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** lhfjobmtajjotb-jlaznsocsa-n
+
** ypzrwbkmtbyptk-bjdjzhngsa-l
 
* molecular-weight:
 
* molecular-weight:
** 175.118
+
** 610.61
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.6.5.4-RXN]]
+
* [[GDR]]
 +
* [[GDR_LPAREN_nadp_RPAREN_]]
 +
* [[GDR_LPAREN_nadp_RPAREN_h]]
 +
* [[GDR_LPAREN_nadp_RPAREN_m]]
 +
* [[GDRh]]
 +
* [[GDRm]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15598]]
+
* [[1.11.1.12-RXN]]
* [[RXN-3521]]
+
* [[1.8.4.9-RXN]]
 +
* [[1.8.5.1-RXN]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[GTHP]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=monodehydroascorbate radical}}
+
{{#set: common-name=glutathione disulfide}}
{{#set: inchi-key=inchikey=lhfjobmtajjotb-jlaznsocsa-n}}
+
{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
{{#set: molecular-weight=175.118}}
+
{{#set: molecular-weight=610.61}}

Revision as of 09:24, 27 August 2019

Metabolite OXIDIZED-GLUTATHIONE

  • common-name:
    • glutathione disulfide
  • smiles:
    • c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • ypzrwbkmtbyptk-bjdjzhngsa-l
  • molecular-weight:
    • 610.61

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality