Difference between revisions of "SJ12260"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * common-...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-Heterodimers Tubulin-Heterodimers] == * common-name: ** an α/β tubulin heter...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Tubulin-Heterodimers Tubulin-Heterodimers] ==
 
* common-name:
 
* common-name:
** 2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol
+
** an α/β tubulin heterodimer
* smiles:
 
** cc(op([o-])([o-])=o)(co)c(o)cop(op([o-])(=o)occ2(c(c(o)c(n1(c(n=c(c=c1)n)=o))o2)o))([o-])=o
 
* inchi-key:
 
** htjxtkbiuvfuar-xhibxcghsa-j
 
* molecular-weight:
 
** 597.259
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-302]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.148-RXN]]
+
* [[3.6.4.3-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-phospho-4-(cytidine 5'-diphospho)-2-c-methyl-d-erythritol}}
+
{{#set: common-name=an α/β tubulin heterodimer}}
{{#set: inchi-key=inchikey=htjxtkbiuvfuar-xhibxcghsa-j}}
 
{{#set: molecular-weight=597.259}}
 

Revision as of 09:24, 27 August 2019

Metabolite Tubulin-Heterodimers

  • common-name:
    • an α/β tubulin heterodimer

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality