Difference between revisions of "SJ14860"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11540 CPD-11540] == * common-name: ** udp-4-dehydro-β-l-rhamnose * smiles: ** cc3(c(=o...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=m7G5-pppAm-mRNAs m7G5-pppAm-mRNAs] == * common-name: ** a 5'-(n7-methyl 5'-triphosphoguanosine)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11540 CPD-11540] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=m7G5-pppAm-mRNAs m7G5-pppAm-mRNAs] ==
 
* common-name:
 
* common-name:
** udp-4-dehydro-β-l-rhamnose
+
** a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyladenosine)-[mrna]
* smiles:
 
** cc3(c(=o)c(o)c(o)c(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)o3)
 
* inchi-key:
 
** ddwgqqadoimfoi-tyenrrdnsa-l
 
* molecular-weight:
 
** 546.274
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10740]]
+
* [[2.1.1.62-RXN]]
* [[RXN-18332]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18332]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-4-dehydro-β-l-rhamnose}}
+
{{#set: common-name=a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyladenosine)-[mrna]}}
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-tyenrrdnsa-l}}
 
{{#set: molecular-weight=546.274}}
 

Revision as of 09:24, 27 August 2019

Metabolite m7G5-pppAm-mRNAs

  • common-name:
    • a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyladenosine)-[mrna]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a 5'-(n7-methyl 5'-triphosphoguanosine)-(2'-o-methyladenosine)-[mrna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.