Difference between revisions of "SJ11377"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] == * common-name: ** ergost-7-enol * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == * common-name: ** kaempferol * smiles: ** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-90 CPD1F-90] == |
* common-name: | * common-name: | ||
| − | ** | + | ** kaempferol |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c=c(o)c=cc(c1(=c([o-])c(=o)c2(c(o)=cc(o)=cc(o1)=2)))=3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** iyrmwmyzsqpjkc-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 285.232 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12510]] |
| + | * [[RXN-13935]] | ||
| + | * [[RXN1F-461]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN1F-93]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=kaempferol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=iyrmwmyzsqpjkc-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=285.232}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD1F-90
- common-name:
- kaempferol
- smiles:
- c3(c=c(o)c=cc(c1(=c([o-])c(=o)c2(c(o)=cc(o)=cc(o1)=2)))=3)
- inchi-key:
- iyrmwmyzsqpjkc-uhfffaoysa-m
- molecular-weight:
- 285.232
