Difference between revisions of "SJ11389"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12825 CPD-12825] == * common-name: ** d-threitol * smiles: ** c(c(c(co)o)o)o * inchi-key: *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] == * common-name: ** sinapyl alcohol * smiles: ** coc1(c=c(c=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SINAPYL-ALCOHOL SINAPYL-ALCOHOL] == |
* common-name: | * common-name: | ||
| − | ** | + | ** sinapyl alcohol |
* smiles: | * smiles: | ||
| − | ** c(c(c( | + | ** coc1(c=c(c=cco)c=c(oc)c(o)=1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lzfopexouvtgjs-onegzznksa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 210.229 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-1125]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=sinapyl alcohol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lzfopexouvtgjs-onegzznksa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=210.229}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite SINAPYL-ALCOHOL
- common-name:
- sinapyl alcohol
- smiles:
- coc1(c=c(c=cco)c=c(oc)c(o)=1)
- inchi-key:
- lzfopexouvtgjs-onegzznksa-n
- molecular-weight:
- 210.229
