Difference between revisions of "SJ04162"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ILE-tRNAs ILE-tRNAs] == * common-name: ** a trnaile == Reaction(s) known to consume the compoun...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] == * common-name: ** l-saccharopine * smiles: ** c(cc[n+]c(ccc([o-])...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SACCHAROPINE SACCHAROPINE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-saccharopine |
| + | * smiles: | ||
| + | ** c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o | ||
| + | * inchi-key: | ||
| + | ** zdgjahtzvhvlot-yumqzzprsa-m | ||
| + | * molecular-weight: | ||
| + | ** 275.281 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.5.1.9-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-saccharopine}} |
| + | {{#set: inchi-key=inchikey=zdgjahtzvhvlot-yumqzzprsa-m}} | ||
| + | {{#set: molecular-weight=275.281}} | ||
Revision as of 09:24, 27 August 2019
Contents
Metabolite SACCHAROPINE
- common-name:
- l-saccharopine
- smiles:
- c(cc[n+]c(ccc([o-])=o)c([o-])=o)cc([n+])c([o-])=o
- inchi-key:
- zdgjahtzvhvlot-yumqzzprsa-m
- molecular-weight:
- 275.281
