Difference between revisions of "SJ19006"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Phosphoglucomutase Phosphoglucomutase] == * common-name: ** a phosphoglucomutase == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == * common-name: ** xllg xyloglucan oligosaccharide * smiles: ** c9(c(c(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13378 CPD-13378] == |
* common-name: | * common-name: | ||
− | ** | + | ** xllg xyloglucan oligosaccharide |
+ | * smiles: | ||
+ | ** c9(c(c(c(c(occ8(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(c(c(c(o2)co)o)o)o)))3)oc6(c(o)c(o)c(oc(coc4(c(c(c(co4)o)o)oc5(c(c(c(c(o5)co)o)o)o)))6)oc7(c(o)c(o)c(o)oc(co)7))))c(o)c(o)c(o)8))o9)o)o)o) | ||
+ | * inchi-key: | ||
+ | ** gschigxdtvyeem-migiythbsa-n | ||
+ | * molecular-weight: | ||
+ | ** 1387.215 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-12400]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=xllg xyloglucan oligosaccharide}} |
+ | {{#set: inchi-key=inchikey=gschigxdtvyeem-migiythbsa-n}} | ||
+ | {{#set: molecular-weight=1387.215}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-13378
- common-name:
- xllg xyloglucan oligosaccharide
- smiles:
- c9(c(c(c(c(occ8(oc(oc3(c(o)c(o)c(oc(coc1(c(c(c(co1)o)o)oc2(c(c(c(c(o2)co)o)o)o)))3)oc6(c(o)c(o)c(oc(coc4(c(c(c(co4)o)o)oc5(c(c(c(c(o5)co)o)o)o)))6)oc7(c(o)c(o)c(o)oc(co)7))))c(o)c(o)c(o)8))o9)o)o)o)
- inchi-key:
- gschigxdtvyeem-migiythbsa-n
- molecular-weight:
- 1387.215