Difference between revisions of "SJ02725"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05219 == * transcription-direction: ** positive * right-end-position: ** 92228 * left-end-position: ** 77297 * centisome-position: ** 81.13978...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: **...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == |
− | * | + | * common-name: |
− | ** | + | ** d-myo-inositol 1,3,4,5,6-pentakisphosphate |
− | + | * smiles: | |
− | + | ** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1) | |
− | + | * inchi-key: | |
− | * | + | ** ctpqaxvnygzuaj-kxxvrosksa-d |
− | + | * molecular-weight: | |
− | ** | + | ** 569.977 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-10963]] | |
− | = | + | * [[RXN-13197]] |
− | + | * [[RXN-7163]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.7.1.134-RXN]] | |
− | + | * [[2.7.1.140-RXN]] | |
− | * | + | * [[RXN-10963]] |
− | ** | + | * [[RXN-13197]] |
− | * | + | * [[RXN-7162]] |
− | ** | + | * [[RXN-7184]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}} |
− | * | + | {{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}} |
− | == | + | {{#set: molecular-weight=569.977}} |
− | * [[ | ||
− | * | ||
− | * [[ | ||
− | * | ||
− | * [[ | ||
− | * | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 09:25, 27 August 2019
Contents
Metabolite CPD-1107
- common-name:
- d-myo-inositol 1,3,4,5,6-pentakisphosphate
- smiles:
- c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
- inchi-key:
- ctpqaxvnygzuaj-kxxvrosksa-d
- molecular-weight:
- 569.977