Difference between revisions of "SJ12659"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20131 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == * common-name: ** trans-4-hydroxy-l-proline * smile...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-HYDROXY-L-PROLINE 4-HYDROXY-L-PROLINE] == |
− | + | * common-name: | |
− | * | + | ** trans-4-hydroxy-l-proline |
− | + | * smiles: | |
− | * | + | ** c1([n+]c(c(=o)[o-])cc(o)1) |
− | * | + | * inchi-key: |
− | ** | + | ** pmmyeevymwasqn-dmtcnviqsa-n |
− | == | + | * molecular-weight: |
− | * [[ | + | ** 131.131 |
− | + | == Reaction(s) known to consume the compound == | |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN490-3641]] | |
− | {{#set: | + | * [[RXN66-546]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=trans-4-hydroxy-l-proline}} |
+ | {{#set: inchi-key=inchikey=pmmyeevymwasqn-dmtcnviqsa-n}} | ||
+ | {{#set: molecular-weight=131.131}} |
Revision as of 09:25, 27 August 2019
Contents
Metabolite 4-HYDROXY-L-PROLINE
- common-name:
- trans-4-hydroxy-l-proline
- smiles:
- c1([n+]c(c(=o)[o-])cc(o)1)
- inchi-key:
- pmmyeevymwasqn-dmtcnviqsa-n
- molecular-weight:
- 131.131