Difference between revisions of "PWY-6861"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CONIFERYL-ALDEHYDE CONIFERYL-ALDEHYDE] ==
+== Pathway PWY-6525 ==
+* taxonomic-range:
+** tax-3568
 * common-name:
-** coniferaldehyde
+** stellariose and mediose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** coc1(=cc(c=cc=o)=cc=c(o)1)
+* [[2.4.1.123-RXN]]
-* inchi-key:
+* [[2.4.1.82-RXN]]
-** dkzbbwmurdfhne-nscuhmnnsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-11491 RXN-11491]
-** 178.187
+* [NoneRXN-11490 RXN-11490]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-11492 RXN-11492]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-3568}}
-* [[RXN-1106]]
+{{#set: common-name=stellariose and mediose biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=2}}
-{{#set: common-name=coniferaldehyde}}
+{{#set: completion rate=0.4}}
-{{#set: inchi-key=inchikey=dkzbbwmurdfhne-nscuhmnnsa-n}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=178.187}}