Difference between revisions of "PWY66-394"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18312 CPD-18312] ==
+== Pathway TRPKYNCAT-PWY ==
+* taxonomic-range:
+** tax-1239
 * common-name:
-** n-3-fumaramoyl-l-2,3-diaminopropanoate
+** l-tryptophan degradation iv (via indole-3-lactate)
-* smiles:
+== Reaction(s) found ==
-** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
+* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ujvdeptvvyupmx-qphdtyrisa-n
+* [NoneINDOLELACTATE-DEHYDROGENASE-RXN INDOLELACTATE-DEHYDROGENASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-1239}}
-** 201.182
+{{#set: common-name=l-tryptophan degradation iv (via indole-3-lactate)}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-16291]]
+{{#set: completion rate=0.5}}
-* [[RXN-16292]]
+{{#set: nb total reaction=2}}
-* [[RXN-16293]]
-== Reaction(s) known to produce the compound ==
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=n-3-fumaramoyl-l-2,3-diaminopropanoate}}
-{{#set: inchi-key=inchikey=ujvdeptvvyupmx-qphdtyrisa-n}}
-{{#set: molecular-weight=201.182}}